Ellison, C.M.; Cronin, M.T.D.; Madden, J.C.; Schultz, T.W. Definition of the structural domain of the baseline non-polar narcosis model for Tetrahymena pyriformis. SAR QSAR Environ. Res. 2008, 19, 7-8, 751–783.
Compound
| ID: | 424 | |
|---|---|---|
| Name: | Ethyl 3-pyridylacetate | |
| Description: | InChI code was generated with Jchem for Excel | |
| Labels: | Pyridine | |
| CAS: | 39931-77-6 | |
| InChi Code: | InChI=1S/C9H11NO2/c1-2-12-9(11)6-8-4-3-5-10-7-8/h3-5,7H,2,6H2,1H3 |
Properties
pIGC50: 40-h Tetrahymena toxicity as log(1/IGC50) [log(L/mmol)]
| Value | Source or prediction |
|---|---|
| -0.94 |
experimental value |
| -0.93 |
Eq2: Saturated alcohols and ketones (Test set) |