Ellison, C.M.; Cronin, M.T.D.; Madden, J.C.; Schultz, T.W. Definition of the structural domain of the baseline non-polar narcosis model for Tetrahymena pyriformis. SAR QSAR Environ. Res. 2008, 19, 7-8, 751–783.
Compound
| ID: | 381 | |
|---|---|---|
| Name: | 1,7-Phenanthroline | |
| Description: | InChI code was generated with Jchem for Excel | |
| Labels: | Polycyclic, N-heterocyclic | |
| CAS: | 230-46-6 | |
| InChi Code: | InChI=1S/C12H8N2/c1-3-9-5-6-11-10(4-2-7-13-11)12(9)14-8-1/h1-8H |
Properties
pIGC50: 40-h Tetrahymena toxicity as log(1/IGC50) [log(L/mmol)]
| Value | Source or prediction |
|---|---|
| 1.07 |
experimental value |
| -0.05 |
Eq2: Saturated alcohols and ketones (Test set) |