| ID: | 378 | |
|---|---|---|
| Name: | β-Ethylphenethyl alcohol | |
| Description: | InChI code was generated with Jchem for Excel | |
| Labels: | Phenethyl, alcohol | |
| CAS: | 89104-46-1 | |
| InChi Code: | InChI=1S/C10H14O/c1-2-9(8-11)10-6-4-3-5-7-10/h3-7,9,11H,2,8H2,1H3 |
pIGC50: 40-h Tetrahymena toxicity as log(1/IGC50) [log(L/mmol)]
| Value | Source or prediction |
|---|---|
| -0.11 |
experimental value |
| -0.08 |
Eq2: Saturated alcohols and ketones (Test set) |