Ellison, C.M.; Cronin, M.T.D.; Madden, J.C.; Schultz, T.W. Definition of the structural domain of the baseline non-polar narcosis model for Tetrahymena pyriformis. SAR QSAR Environ. Res. 2008, 19, 7-8, 751–783.
Compound
| ID: | 377 | |
|---|---|---|
| Name: | (±)-1-Phenyl-2-pentanol | |
| Description: | InChI code was generated with Jchem for Excel | |
| Labels: | Phenethyl, alcohol | |
| CAS: | 705-73-7 | |
| InChi Code: | InChI=1S/C11H16O/c1-2-6-11(12)9-10-7-4-3-5-8-10/h3-5,7-8,11-12H,2,6,9H2,1H3 |
Properties
pIGC50: 40-h Tetrahymena toxicity as log(1/IGC50) [log(L/mmol)]
| Value | Source or prediction |
|---|---|
| 0.16 |
experimental value |
| 0.31 |
Eq2: Saturated alcohols and ketones (Test set) |