| ID: | 37 | |
|---|---|---|
| Name: | 2-Ethyl-1-hexanol | |
| Description: | InChI code was generated with Jchem for Excel | |
| Labels: | ||
| CAS: | 104-76-7 | |
| InChi Code: | InChI=1S/C8H18O/c1-3-5-6-8(4-2)7-9/h8-9H,3-7H2,1-2H3 |
pIGC50: 40-h Tetrahymena toxicity as log(1/IGC50) [log(L/mmol)]
| Value | Source or prediction |
|---|---|
| 0.17 |
experimental value |
| 0.12 |
Eq2: Saturated alcohols and ketones (Training set) |
| 0.18 |
QMRF: Saturated alcohols and ketones (Training set) |
| Link | Resource description |
|---|---|
| DTXSID5020605 | US EPA CompTox Dashboard |