| ID: | 297 | |
|---|---|---|
| Name: | 1-Bromo-3-methylbutane | |
| Description: | InChI code was generated with Jchem for Excel | |
| Labels: | Haloalkane | |
| CAS: | 107-82-4 | |
| InChi Code: | InChI=1S/C5H11Br/c1-5(2)3-4-6/h5H,3-4H2,1-2H3 |
pIGC50: 40-h Tetrahymena toxicity as log(1/IGC50) [log(L/mmol)]
| Value | Source or prediction |
|---|---|
| 0.25 |
experimental value |
| 0.38 |
Eq2: Saturated alcohols and ketones (Test set) |
| Link | Resource description |
|---|---|
| DTXSID7059353 | US EPA CompTox Dashboard |