| ID: | 266 | |
|---|---|---|
| Name: | Methyl trans-3-pentenoate | |
| Description: | InChI code was generated with Jchem for Excel | |
| Labels: | Ester | |
| CAS: | 20515-19-9 | |
| InChi Code: | InChI=1S/C6H10O2/c1-3-4-5-6(7)8-2/h3-4H,5H2,1-2H3/b4-3+ |
pIGC50: 40-h Tetrahymena toxicity as log(1/IGC50) [log(L/mmol)]
| Value | Source or prediction |
|---|---|
| -0.28 |
experimental value |
| -0.74 |
Eq2: Saturated alcohols and ketones (Test set) |