| ID: | 248 | |
|---|---|---|
| Name: | Ethyl (S)-(+)-3-hydroxybutyrate | |
| Description: | InChI code was generated with Jchem for Excel | |
| Labels: | Ester | |
| CAS: | 56816-01-4 | |
| InChi Code: | InChI=1S/C6H12O3/c1-3-9-6(8)4-5(2)7/h5,7H,3-4H2,1-2H3/t5-/m0/s1 |
pIGC50: 40-h Tetrahymena toxicity as log(1/IGC50) [log(L/mmol)]
| Value | Source or prediction |
|---|---|
| -1.53 |
experimental value |
| -1.77 |
Eq2: Saturated alcohols and ketones (Test set) |