| ID: | 245 | |
|---|---|---|
| Name: | n-Caproic acid vinyl ester | |
| Description: | InChI code was generated with Jchem for Excel | |
| Labels: | Ester | |
| CAS: | 3050-69-9 | |
| InChi Code: | InChI=1S/C8H14O2/c1-3-5-6-7-8(9)10-4-2/h4H,2-3,5-7H2,1H3 |
pIGC50: 40-h Tetrahymena toxicity as log(1/IGC50) [log(L/mmol)]
| Value | Source or prediction |
|---|---|
| 0.08 |
experimental value |
| 0.09 |
Eq2: Saturated alcohols and ketones (Test set) |