| ID: | 23 | |
|---|---|---|
| Name: | 2-Octanol | |
| Description: | InChI code was generated with Jchem for Excel | |
| Labels: | ||
| CAS: | 123-96-6 | |
| InChi Code: | InChI=1S/C8H18O/c1-3-4-5-6-7-8(2)9/h8-9H,3-7H2,1-2H3 |
pIGC50: 40-h Tetrahymena toxicity as log(1/IGC50) [log(L/mmol)]
| Value | Source or prediction |
|---|---|
| 0 |
experimental value |
| 0.20 |
Eq1: Saturated alcohols and ketones (Training set) |
| 0.25 |
Eq2: Saturated alcohols and ketones (Training set) |
| 0.18 |
QMRF: Saturated alcohols and ketones (Training set) |
| Link | Resource description |
|---|---|
| DTXSID0027014 | US EPA CompTox Dashboard |