| ID: | 183 | |
|---|---|---|
| Name: | 2-Fluorobenzyl alcohol | |
| Description: | InChI code was generated with Jchem for Excel | |
| Labels: | Benzyl, alcohol | |
| CAS: | 446-51-5 | |
| InChi Code: | InChI=1S/C7H7FO/c8-7-4-2-1-3-6(7)5-9/h1-4,9H,5H2 |
pIGC50: 40-h Tetrahymena toxicity as log(1/IGC50) [log(L/mmol)]
| Value | Source or prediction |
|---|---|
| -0.67 |
experimental value |
| -0.99 |
Eq2: Saturated alcohols and ketones (Test set) |