Ellison, C.M.; Cronin, M.T.D.; Madden, J.C.; Schultz, T.W. Definition of the structural domain of the baseline non-polar narcosis model for Tetrahymena pyriformis. SAR QSAR Environ. Res. 2008, 19, 7-8, 751–783.
Compound
| ID: | 147 | |
|---|---|---|
| Name: | Methyl-4-methoxybenzoate | |
| Description: | InChI code was generated with Jchem for Excel | |
| Labels: | Benzoate | |
| CAS: | 121-98-2 | |
| InChi Code: | InChI=1S/C9H10O3/c1-11-8-5-3-7(4-6-8)9(10)12-2/h3-6H,1-2H3 |
Properties
pIGC50: 40-h Tetrahymena toxicity as log(1/IGC50) [log(L/mmol)]
| Value | Source or prediction |
|---|---|
| 0.31 |
experimental value |
| -0.24 |
Eq2: Saturated alcohols and ketones (Test set) |