ID: | S2 | |
---|---|---|
Name: | Alanycarb | |
Description: | Standard InChI is not able to describe the structure of this compound as given in the article or known databases. | |
Labels: | carbamate | |
CAS: | ||
InChi Code: | InChI=1S/C17H25N3O4S2/c1-5-23-16(21)11-12-20(13-15-9-7-6-8-10-15)26-19(3)17(22)24-18-14(2)25-4/h6-10H,5,11-13H2,1-4H3/b18-14- |
pLD50: 48-h Honeybee toxicity as -log(LD50) [log(bee/micromol)] i
Value | Source or prediction |
---|---|
2.773 |
experimental value |
3 |
Tab1_Consensus: MLR consensus model (Validation set) |
Link | Resource description |
---|---|
DTXSID5058195 | US EPA CompTox Dashboard |