| ID: | Va_2 | |
|---|---|---|
| Name: | Oxythioquinox | |
| Description: | ||
| Labels: | ||
| CAS: | 2439-01-2 | |
| InChi Code: | InChI=1S/C10H6N2OS2/c1-5-2-3-6-7(4-5)12-9-8(11-6)14-10(13)15-9/h2-4H,1H3 |
pLC50: Quail dietary toxicity as log(1/LC50) [-log(mmol/L)]
| Value | Source or prediction |
|---|---|
| -0.9666 |
experimental value |
| -0.31564 |
Eq.3: Model for pesticides (Validation set) |
| Link | Resource description |
|---|---|
| DTXSID2032342 | US EPA CompTox Dashboard |