| ID: | Tr_12 | |
|---|---|---|
| Name: | Chlorophacinone | |
| Description: | ||
| Labels: | ||
| CAS: | 3691-35-8 | |
| InChi Code: | InChI=1S/C23H15ClO3/c24-16-12-10-15(11-13-16)19(14-6-2-1-3-7-14)23(27)20-21(25)17-8-4-5-9-18(17)22(20)26/h1-13,19-20H |
pLC50: Quail dietary toxicity as log(1/LC50) [-log(mmol/L)]
| Value | Source or prediction |
|---|---|
| 0.1905 |
experimental value |
| -0.70713 |
Eq.3: Model for pesticides (Training set) |
| Link | Resource description |
|---|---|
| DTXSID2032348 | US EPA CompTox Dashboard |