| ID: | Tab2_19 | |
|---|---|---|
| Name: | Phenol, 2,4,6-tribromo- | |
| Description: | ||
| Labels: | ||
| CAS: | 118-79-6 | |
| InChi Code: | InChI=1S/C6H3Br3O/c7-3-1-4(8)6(10)5(9)2-3/h1-2,10H |
pEC50: 72-h acute algae toxicity as log(1/EC50) [-log(mmol/L)]
| Value | Source or prediction |
|---|---|
| 2.24 |
experimental value |
| 2.56 |
Eq.4: Model for aromatic amines and phenols (algae) (Training set) |
| Link | Resource description |
|---|---|
| DTXSID6021959 | US EPA CompTox Dashboard |