| ID: | 399 | |
|---|---|---|
| Name: | Azoxystrobin | |
| Description: | ||
| Labels: | Training | |
| CAS: | 131860-33-8 | |
| InChi Code: | InChI=1S/C22H17N3O5/c1-27-13-17(22(26)28-2)16-8-4-6-10-19(16)30-21-11-20(24-14-25-21)29-18-9-5-3-7-15(18)12-23/h3-11,13-14H,1-2H3/b17-13+ |
pEC50: 72-h Algal toxicity as log(1/EC50) [-log(mol/L)] i
| Value | Source or prediction |
|---|---|
| 6.05 |
experimental value |
| 6.263 |
Tab2.1: Model with descriptors from DRAGON (Training set) |
| 5.827 |
Tab2.2: Model with descriptors from PaDEL (Training set) |
| 5.665 |
Tab2.3: Model from QSPR-THESAURUS (Training set) |
| 5.918 |
Tab2.4: CONSENSUS model (Training set) |
| Link | Resource description |
|---|---|
| DTXSID0032520 | US EPA CompTox Dashboard |