| ID: | 92 | |
|---|---|---|
| Name: | 4-amino-3,6-dichloropyridine-2-carboxylic acid | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: Aminopyralid | |
| Labels: | ||
| CAS: | 150114-71-9 | |
| InChi Code: | InChI=1S/C6H4Cl2N2O2/c7-3-1-2(9)4(8)5(10-3)6(11)12/h1H,(H2,9,10)(H,11,12) |
M21.pEC50: 72-h Algal toxicity as log(1/EC50) [-log(mol/L)]
| Value | Source or prediction |
|---|---|
| 3.84 |
experimental value |
| 3.3573 |
Tab2.Model_21: (B)TAZ P. subcapitata EC50 (Training set) |
M22.pEC50: Daphnia toxicity as log(1/EC50) [-log(mol/L)]
| Value | Source or prediction |
|---|---|
| 3.32 |
experimental value |
| 3.4978 |
Tab2.Model_22: (B)TAZ D.magna EC50 (Training set) |
M23.pLC50: 96-h Rainbow trout toxicity as log(1/LC50) [-log(mol/L)]
| Value | Source or prediction |
|---|---|
| 3.32 |
experimental value |
| 3.3889 |
Tab2.Model_23: (B)TAZ O. mykiss LC50 (Training set) |
| Link | Resource description |
|---|---|
| DTXSID2034330 | US EPA CompTox Dashboard |