ID: | 861 | |
---|---|---|
Name: | anthracene-9-carboxylic acid | |
Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: Anthracene-9-carboxylic acid | |
Labels: | ||
CAS: | 723-62-6 | |
InChi Code: | InChI=1S/C15H10O2/c16-15(17)14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9H,(H,16,17) |
M2.logKoc: Soil sorption coefficient as log(Koc) i
Value | Source or prediction |
---|---|
2.69 |
experimental value |
3.143 |
Tab2.Model_2: logKoc (Training set) |
Link | Resource description |
---|---|
DTXSID7049427 | US EPA CompTox Dashboard |