ID: | 780 | |
---|---|---|
Name: | 4-aminobenzoic acid | |
Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: 4-Aminobenzoic acid | |
Labels: | ||
CAS: | 150-13-0 | |
InChi Code: | InChI=1S/C7H7NO2/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,8H2,(H,9,10) |
M2.logKoc: Soil sorption coefficient as log(Koc) i
Value | Source or prediction |
---|---|
2.05 |
experimental value |
1.3803 |
Tab2.Model_2: logKoc (Training set) |
Link | Resource description |
---|---|
DTXSID6024466 | US EPA CompTox Dashboard |