ID: | 713 | |
---|---|---|
Name: | 4-methylbenzoic acid | |
Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: 4-Methylbenzoic acid | |
Labels: | ||
CAS: | 99-94-5 | |
InChi Code: | InChI=1S/C8H8O2/c1-6-2-4-7(5-3-6)8(9)10/h2-5H,1H3,(H,9,10) |
M2.logKoc: Soil sorption coefficient as log(Koc) i
Value | Source or prediction |
---|---|
1.77 |
experimental value |
1.7158 |
Tab2.Model_2: logKoc (Training set) |
Link | Resource description |
---|---|
DTXSID6021618 | US EPA CompTox Dashboard |