ID: | 675 | |
---|---|---|
Name: | 2-(naphthalen-1-yl)acetic acid | |
Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: 1-Naphthalene acetic acid | |
Labels: | ||
CAS: | 86-87-3 | |
InChi Code: | InChI=1S/C12H10O2/c13-12(14)8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7H,8H2,(H,13,14) |
M2.logKoc: Soil sorption coefficient as log(Koc) i
Value | Source or prediction |
---|---|
2.25 |
experimental value |
2.5411 |
Tab2.Model_2: logKoc (Training set) |
Link | Resource description |
---|---|
DTXSID8020915 | US EPA CompTox Dashboard |