| ID: | 624 | |
|---|---|---|
| Name: | 1,2,3,4,7-pentachlorooxanthrene | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: 1,2,3,4,7-pentachlorodibenzo-p-dioxin | |
| Labels: | ||
| CAS: | 39227-61-7 | |
| InChi Code: | InChI=1S/C12H3Cl5O2/c13-4-1-2-5-6(3-4)19-12-10(17)8(15)7(14)9(16)11(12)18-5/h1-3H |
M3.GHLI: Global half-life index i
| Value | Source or prediction |
|---|---|
| 2.34148 |
experimental value |
| 2.7178 |
Tab2.Model_3: Global half-life index (Training set) |
| Link | Resource description |
|---|---|
| DTXSID6074041 | US EPA CompTox Dashboard |