| ID: | 622 | |
|---|---|---|
| Name: | 2-chlorooxanthrene | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: 2,7-dichlorodibenzo-p-dioxin | |
| Labels: | ||
| CAS: | 39227-54-8 | |
| InChi Code: | InChI=1S/C12H7ClO2/c13-8-5-6-11-12(7-8)15-10-4-2-1-3-9(10)14-11/h1-7H |
M3.GHLI: Global half-life index i
| Value | Source or prediction |
|---|---|
| 1.05847 |
experimental value |
| 1.1868 |
Tab2.Model_3: Global half-life index (Training set) |
| Link | Resource description |
|---|---|
| DTXSID90192488 | US EPA CompTox Dashboard |