| ID: | 607 | |
|---|---|---|
| Name: | 1-chloro-4-phenoxybenzene | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: benzene, 1-chloro-4-phenoxy- | |
| Labels: | ||
| CAS: | 7005-72-3 | |
| InChi Code: | InChI=1S/C12H9ClO/c13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11/h1-9H |
M3.GHLI: Global half-life index i
| Value | Source or prediction |
|---|---|
| -0.47674 |
experimental value |
| 1.0934 |
Tab2.Model_3: Global half-life index (Training set) |
| Link | Resource description |
|---|---|
| DTXSID2052447 | US EPA CompTox Dashboard |