| ID: | 605 | |
|---|---|---|
| Name: | 1-chloro-2-[2,2-dichloro-1-(4-chlorophenyl)ethenyl]benzene | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: 1-(2-chlorophenyl)-1-(4-chlorophenyl)- 2,2-dichloroethylene | |
| Labels: | ||
| CAS: | 3424-82-6 | |
| InChi Code: | InChI=1S/C14H8Cl4/c15-10-7-5-9(6-8-10)13(14(17)18)11-3-1-2-4-12(11)16/h1-8H |
M3.GHLI: Global half-life index i
| Value | Source or prediction |
|---|---|
| 3.7764 |
experimental value |
| 3.0271 |
Tab2.Model_3: Global half-life index (Training set) |
| Link | Resource description |
|---|---|
| DTXSID4022313 | US EPA CompTox Dashboard |