| ID: | 587 | |
|---|---|---|
| Name: | pentyl acetate | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: acetic acid, pentyl ester | |
| Labels: | ||
| CAS: | 628-63-7 | |
| InChi Code: | InChI=1S/C7H14O2/c1-3-4-5-6-9-7(2)8/h3-6H2,1-2H3 |
M3.GHLI: Global half-life index i
| Value | Source or prediction |
|---|---|
| -1.59781 |
experimental value |
| -1.57 |
Tab2.Model_3: Global half-life index (Training set) |
| Link | Resource description |
|---|---|
| DTXSID1027263 | US EPA CompTox Dashboard |