| ID: | 585 | |
|---|---|---|
| Name: | but-3-enoic acid | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: 3-butenoic acid | |
| Labels: | ||
| CAS: | 625-38-7 | |
| InChi Code: | InChI=1S/C4H6O2/c1-2-3-4(5)6/h2H,1,3H2,(H,5,6) |
M3.GHLI: Global half-life index i
| Value | Source or prediction |
|---|---|
| -1.84173 |
experimental value |
| -1.8479 |
Tab2.Model_3: Global half-life index (Training set) |
| Link | Resource description |
|---|---|
| DTXSID60211539 | US EPA CompTox Dashboard |