| ID: | 58 | |
|---|---|---|
| Name: | 4,6-dimethyl-1,2-dihydropyrimidin-2-imine | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: 2-amino-4,6-dimethyl pyrimidine | |
| Labels: | ||
| CAS: | 767-15-7 | |
| InChi Code: | InChI=1S/C6H9N3/c1-4-3-5(2)9-6(7)8-4/h3H,1-2H3,(H2,7,8,9) |
M21.pEC50: 72-h Algal toxicity as log(1/EC50) [-log(mol/L)]
| Value | Source or prediction |
|---|---|
| 3.09 |
experimental value |
| 3.3145 |
Tab2.Model_21: (B)TAZ P. subcapitata EC50 (Training set) |
M22.pEC50: Daphnia toxicity as log(1/EC50) [-log(mol/L)]
| Value | Source or prediction |
|---|---|
| 3.09 |
experimental value |
| 3.7385 |
Tab2.Model_22: (B)TAZ D.magna EC50 (Training set) |
M23.pLC50: 96-h Rainbow trout toxicity as log(1/LC50) [-log(mol/L)]
| Value | Source or prediction |
|---|---|
| 3.09 |
experimental value |
| 3.2019 |
Tab2.Model_23: (B)TAZ O. mykiss LC50 (Training set) |