| ID: | 574 | |
|---|---|---|
| Name: | 2-methyl-4,6-dinitrophenol | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: 4,6-Dinitro-o-cresol The representation of nitro groups was fixed | |
| Labels: | ||
| CAS: | 534-52-1 | |
| InChi Code: | InChI=1S/C7H6N2O5/c1-4-2-5(8(11)12)3-6(7(4)10)9(13)14/h2-3,10H,1H3 |
M1.pLC50: 96-h Fathead minnow toxicity as log(1/LC50) [-log(mol/L)]
| Value | Source or prediction |
|---|---|
| 5.06 |
experimental value |
| 4.6357 |
Tab2.Model_1: P. promelas LC50 (Training set) |
M3.GHLI: Global half-life index i
| Value | Source or prediction |
|---|---|
| 0.36039 |
experimental value |
| -0.802 |
Tab2.Model_3: Global half-life index (Training set) |
| Link | Resource description |
|---|---|
| DTXSID1022053 | US EPA CompTox Dashboard |