ID: | 53 | |
---|---|---|
Name: | 3,6-dichloropyridine-2-carboxylic acid | |
Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: Clopyralid | |
Labels: | ||
CAS: | 1702-17-6 | |
InChi Code: | InChI=1S/C6H3Cl2NO2/c7-3-1-2-4(8)9-5(3)6(10)11/h1-2H,(H,10,11) |
M22.pEC50: Daphnia toxicity as log(1/EC50) [-log(mol/L)]
Value | Source or prediction |
---|---|
3.29 |
experimental value |
3.8858 |
Tab2.Model_22: (B)TAZ D.magna EC50 (Training set) |
Link | Resource description |
---|---|
DTXSID9029221 | US EPA CompTox Dashboard |