| ID: | 491 | |
|---|---|---|
| Name: | butanoic acid | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: butanoic acid | |
| Labels: | ||
| CAS: | 107-92-6 | |
| InChi Code: | InChI=1S/C4H8O2/c1-2-3-4(5)6/h2-3H2,1H3,(H,5,6) |
M3.GHLI: Global half-life index i
| Value | Source or prediction |
|---|---|
| -1.59781 |
experimental value |
| -1.9776 |
Tab2.Model_3: Global half-life index (Training set) |
| Link | Resource description |
|---|---|
| DTXSID8021515 | US EPA CompTox Dashboard |