| ID: | 411 | |
|---|---|---|
| Name: | 2-hydroxybenzoic acid | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: benzoic acid, 2-hydroxy- | |
| Labels: | ||
| CAS: | 69-72-7 | |
| InChi Code: | InChI=1S/C7H6O3/c8-6-4-2-1-3-5(6)7(9)10/h1-4,8H,(H,9,10) |
M3.GHLI: Global half-life index i
| Value | Source or prediction |
|---|---|
| -1.59781 |
experimental value |
| -1.7773 |
Tab2.Model_3: Global half-life index (Training set) |
| Link | Resource description |
|---|---|
| DTXSID7026368 | US EPA CompTox Dashboard |