ID: | 349 | |
---|---|---|
Name: | butyl 2-methylprop-2-enoate | |
Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: Butylmethacrylate | |
Labels: | ||
CAS: | 97-88-1 | |
InChi Code: | InChI=1S/C8H14O2/c1-4-5-6-10-8(9)7(2)3/h2,4-6H2,1,3H3 |
M7.pEC50: Daphnia toxicity as log(1/LC50) [-log(mmol/L)]
Value | Source or prediction |
---|---|
0.65 |
experimental value |
0.8675 |
Tab2.Model_7: Esters D. magna EC50 (Training set) |
Link | Resource description |
---|---|
DTXSID4024696 | US EPA CompTox Dashboard |