ID: | 255 | |
---|---|---|
Name: | (3S,7S)-7,14,16-trihydroxy-3-methyl-3,4,5,6,7,8,9,10,11,12-decahydro-1H-2-benzoxacyclotetradecin-1-one | |
Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: b-Zearalanol | |
Labels: | ||
CAS: | 42422-68-4 | |
InChi Code: | InChI=1S/C18H26O5/c1-12-6-5-9-14(19)8-4-2-3-7-13-10-15(20)11-16(21)17(13)18(22)23-12/h10-12,14,19-21H,2-9H2,1H3/t12-,14-/m0/s1 |
M4.logRBA: Estrogen receptor relative binding affinity as log(RBA)
Value | Source or prediction |
---|---|
-0.19 |
experimental value |
0.2988 |
Tab2.Model_4: EDC estrogen receptor binding (Training set) |
Link | Resource description |
---|---|
DTXSID3022532 | US EPA CompTox Dashboard |