ID: | 232 | |
---|---|---|
Name: | 3-[(1E)-1-{4-[2-(dimethylamino)ethoxy]phenyl}-2-phenylbut-1-en-1-yl]phenol | |
Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: Droloxifene | |
Labels: | ||
CAS: | 82413-20-5 | |
InChi Code: | InChI=1S/C26H29NO2/c1-4-25(20-9-6-5-7-10-20)26(22-11-8-12-23(28)19-22)21-13-15-24(16-14-21)29-18-17-27(2)3/h5-16,19,28H,4,17-18H2,1-3H3/b26-25+ |
M4.logRBA: Estrogen receptor relative binding affinity as log(RBA)
Value | Source or prediction |
---|---|
1.18 |
experimental value |
1.4999 |
Tab2.Model_4: EDC estrogen receptor binding (Training set) |
Link | Resource description |
---|---|
DTXSID9022441 | US EPA CompTox Dashboard |