| ID: | 216 | |
|---|---|---|
| Name: | 1,2-dibromo-4-(2-bromophenoxy)benzene | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: 2,3',4'-triBDE | |
| Labels: | ||
| CAS: | 147217-78-5 | |
| InChi Code: | InChI=1S/C12H7Br3O/c13-9-6-5-8(7-11(9)15)16-12-4-2-1-3-10(12)14/h1-7H |
M11.pPL: Subcooled liquid vapour pressure as log(1/PL) [-log(Pa)] i
| Value | Source or prediction |
|---|---|
| 2.75 |
experimental value |
| 2.654 |
Tab2.Model_11: BFR vapor pressure (Training set) |
| Link | Resource description |
|---|---|
| DTXSID5024348 | US EPA CompTox Dashboard |