| ID: | 2013 | |
|---|---|---|
| Name: | 2-butoxyethyl acetate | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: 2-Butoxyethyl acetate | |
| Labels: | ||
| CAS: | 112-07-2 | |
| InChi Code: | InChI=1S/C8H16O3/c1-3-4-5-10-6-7-11-8(2)9/h3-7H2,1-2H3 |
M7.pEC50: Daphnia toxicity as log(1/LC50) [-log(mmol/L)]
| Value | Source or prediction |
|---|---|
| 0.64 |
experimental value |
| 0.0288 |
Tab2.Model_7: Esters D. magna EC50 (Training set) |
| Link | Resource description |
|---|---|
| DTXSID1026904 | US EPA CompTox Dashboard |