| ID: | 1854 | |
|---|---|---|
| Name: | 6-chloropyridin-2-ol | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: 6-Chloro-2-pyridinol | |
| Labels: | ||
| CAS: | 16879-02-0 | |
| InChi Code: | InChI=1S/C5H4ClNO/c6-4-2-1-3-5(8)7-4/h1-3H,(H,7,8) |
M1.pLC50: 96-h Fathead minnow toxicity as log(1/LC50) [-log(mol/L)]
| Value | Source or prediction |
|---|---|
| 2.78 |
experimental value |
| 3.0123 |
Tab2.Model_1: P. promelas LC50 (Training set) |
| Link | Resource description |
|---|---|
| DTXSID6022268 | US EPA CompTox Dashboard |