| ID: | 1846 | |
|---|---|---|
| Name: | 1,2-bis(dibromomethyl)benzene | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: a,a,a',a'-Tetrabromo-o-xylene | |
| Labels: | ||
| CAS: | 13209-15-9 | |
| InChi Code: | InChI=1S/C8H6Br4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4,7-8H |
M1.pLC50: 96-h Fathead minnow toxicity as log(1/LC50) [-log(mol/L)]
| Value | Source or prediction |
|---|---|
| 5.99 |
experimental value |
| 6.2485 |
Tab2.Model_1: P. promelas LC50 (Training set) |
| Link | Resource description |
|---|---|
| DTXSID7022255 | US EPA CompTox Dashboard |