ID: | 1827 | |
---|---|---|
Name: | 1,3-dimethoxy-2-methylbenzene | |
Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: 2,6-Dimethoxytoluene | |
Labels: | ||
CAS: | 5673-07-4 | |
InChi Code: | InChI=1S/C9H12O2/c1-7-8(10-2)5-4-6-9(7)11-3/h4-6H,1-3H3 |
M1.pLC50: 96-h Fathead minnow toxicity as log(1/LC50) [-log(mol/L)]
Value | Source or prediction |
---|---|
3.88 |
experimental value |
3.9235 |
Tab2.Model_1: P. promelas LC50 (Training set) |
Link | Resource description |
---|---|
DTXSID4022230 | US EPA CompTox Dashboard |