| ID: | 1814 | |
|---|---|---|
| Name: | 2,6-diphenylpyridine | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: 2,6-Diphenylpyridine | |
| Labels: | ||
| CAS: | 3558-69-8 | |
| InChi Code: | InChI=1S/C17H13N/c1-3-8-14(9-4-1)16-12-7-13-17(18-16)15-10-5-2-6-11-15/h1-13H |
M1.pLC50: 96-h Fathead minnow toxicity as log(1/LC50) [-log(mol/L)]
| Value | Source or prediction |
|---|---|
| 6.04 |
experimental value |
| 5.4664 |
Tab2.Model_1: P. promelas LC50 (Training set) |
| Link | Resource description |
|---|---|
| DTXSID7022209 | US EPA CompTox Dashboard |