| ID: | 1807 | |
|---|---|---|
| Name: | benzyl 2-methylprop-2-enoate | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: Benzyl methacrylate | |
| Labels: | ||
| CAS: | 2495-37-6 | |
| InChi Code: | InChI=1S/C11H12O2/c1-9(2)11(12)13-8-10-6-4-3-5-7-10/h3-7H,1,8H2,2H3 |
M1.pLC50: 96-h Fathead minnow toxicity as log(1/LC50) [-log(mol/L)]
| Value | Source or prediction |
|---|---|
| 4.58 |
experimental value |
| 4.4263 |
Tab2.Model_1: P. promelas LC50 (Training set) |
| Link | Resource description |
|---|---|
| DTXSID0022193 | US EPA CompTox Dashboard |