| ID: | 1759 | |
|---|---|---|
| Name: | 2,3,4,5,6-pentafluoroaniline | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: Pentafluoroaniline | |
| Labels: | ||
| CAS: | 771-60-8 | |
| InChi Code: | InChI=1S/C6H2F5N/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H2 |
M1.pLC50: 96-h Fathead minnow toxicity as log(1/LC50) [-log(mol/L)]
| Value | Source or prediction |
|---|---|
| 3.69 |
experimental value |
| 4.4519 |
Tab2.Model_1: P. promelas LC50 (Training set) |
| Link | Resource description |
|---|---|
| DTXSID8022119 | US EPA CompTox Dashboard |