| ID: | 1755 | |
|---|---|---|
| Name: | N,N-dibutylformamide | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: N,N-Dibutylformamide | |
| Labels: | ||
| CAS: | 761-65-9 | |
| InChi Code: | InChI=1S/C9H19NO/c1-3-5-7-10(9-11)8-6-4-2/h9H,3-8H2,1-2H3 |
M1.pLC50: 96-h Fathead minnow toxicity as log(1/LC50) [-log(mol/L)]
| Value | Source or prediction |
|---|---|
| 3.25 |
experimental value |
| 3.4696 |
Tab2.Model_1: P. promelas LC50 (Training set) |
| Link | Resource description |
|---|---|
| DTXSID3022114 | US EPA CompTox Dashboard |