| ID: | 1736 | |
|---|---|---|
| Name: | 2-chloro-4-methylaniline | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: 2-Chloro-4-methylaniline | |
| Labels: | ||
| CAS: | 615-65-6 | |
| InChi Code: | InChI=1S/C7H8ClN/c1-5-2-3-7(9)6(8)4-5/h2-4H,9H2,1H3 |
M1.pLC50: 96-h Fathead minnow toxicity as log(1/LC50) [-log(mol/L)]
| Value | Source or prediction |
|---|---|
| 3.6 |
experimental value |
| 3.7512 |
Tab2.Model_1: P. promelas LC50 (Training set) |
| Link | Resource description |
|---|---|
| DTXSID3022083 | US EPA CompTox Dashboard |