ID: | 1727 | |
---|---|---|
Name: | 3-methylbutanal | |
Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: Isovaleraldehyde | |
Labels: | ||
CAS: | 590-86-3 | |
InChi Code: | InChI=1S/C5H10O/c1-5(2)3-4-6/h4-5H,3H2,1-2H3 |
M1.pLC50: 96-h Fathead minnow toxicity as log(1/LC50) [-log(mol/L)]
Value | Source or prediction |
---|---|
4.42 |
experimental value |
2.861 |
Tab2.Model_1: P. promelas LC50 (Training set) |
Link | Resource description |
---|---|
DTXSID1021619 | US EPA CompTox Dashboard |