| ID: | 1726 | |
|---|---|---|
| Name: | 4-ethylaniline | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: 4-Ethylaniline | |
| Labels: | ||
| CAS: | 589-16-2 | |
| InChi Code: | InChI=1S/C8H11N/c1-2-7-3-5-8(9)6-4-7/h3-6H,2,9H2,1H3 |
M1.pLC50: 96-h Fathead minnow toxicity as log(1/LC50) [-log(mol/L)]
| Value | Source or prediction |
|---|---|
| 3.22 |
experimental value |
| 3.5496 |
Tab2.Model_1: P. promelas LC50 (Training set) |
| Link | Resource description |
|---|---|
| DTXSID0022066 | US EPA CompTox Dashboard |