| ID: | 1719 | |
|---|---|---|
| Name: | 1-(2-hydroxy-4-methoxyphenyl)ethan-1-one | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: 2-Hydroxy-4-methoxyacetophenone | |
| Labels: | ||
| CAS: | 552-41-0 | |
| InChi Code: | InChI=1S/C9H10O3/c1-6(10)8-4-3-7(12-2)5-9(8)11/h3-5,11H,1-2H3 |
M1.pLC50: 96-h Fathead minnow toxicity as log(1/LC50) [-log(mol/L)]
| Value | Source or prediction |
|---|---|
| 3.38 |
experimental value |
| 4.0124 |
Tab2.Model_1: P. promelas LC50 (Training set) |
| Link | Resource description |
|---|---|
| DTXSID1022059 | US EPA CompTox Dashboard |