ID: | 1712 | |
---|---|---|
Name: | nonan-5-one | |
Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: 5-Nonanone | |
Labels: | ||
CAS: | 502-56-7 | |
InChi Code: | InChI=1S/C9H18O/c1-3-5-7-9(10)8-6-4-2/h3-8H2,1-2H3 |
M1.pLC50: 96-h Fathead minnow toxicity as log(1/LC50) [-log(mol/L)]
Value | Source or prediction |
---|---|
3.66 |
experimental value |
4.6032 |
Tab2.Model_1: P. promelas LC50 (Training set) |
Link | Resource description |
---|---|
DTXSID7022045 | US EPA CompTox Dashboard |